Products 912331-27-2

CAS 912331-27-2 appears in our catalog under these names: (3–Methylbenzo(b)thiophen–2–yl)boronic acid, (3-Methyl-1-benzothiophen-2-yl)boronic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

(3-methyl-1-benzothiophen-2-yl)boronic acid (CAS 912331-27-2) is a chemical compound with the molecular formula C9H9BO2S and a molecular weight of 192.05 g/mol. IUPAC name: (3-methyl-1-benzothiophen-2-yl)boronic acid. InChIKey: CSWLIEDSUBZBDL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BO2S
Molecular weight192.05 g/mol
IUPAC name(3-methyl-1-benzothiophen-2-yl)boronic acid
InChIKeyCSWLIEDSUBZBDL-UHFFFAOYSA-N
SMILESB(C1=C(C2=CC=CC=C2S1)C)(O)O

Computed by PubChem (NCBI)