CAS 912331-27-2 appears in our catalog under these names: (3–Methylbenzo(b)thiophen–2–yl)boronic acid, (3-Methyl-1-benzothiophen-2-yl)boronic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3-methyl-1-benzothiophen-2-yl)boronic acid (CAS 912331-27-2) is a chemical compound with the molecular formula C9H9BO2S and a molecular weight of 192.05 g/mol. IUPAC name: (3-methyl-1-benzothiophen-2-yl)boronic acid. InChIKey: CSWLIEDSUBZBDL-UHFFFAOYSA-N.
| Molecular formula | C9H9BO2S |
|---|---|
| Molecular weight | 192.05 g/mol |
| IUPAC name | (3-methyl-1-benzothiophen-2-yl)boronic acid |
| InChIKey | CSWLIEDSUBZBDL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C2=CC=CC=C2S1)C)(O)O |
Computed by PubChem (NCBI)