CAS 13407-16-4 is the registry number for alpha-Chloromethyl-4-nitrobenzenemethanol. Offered by: TRC. Available pack sizes: 2,5g.
2-chloro-1-(4-nitrophenyl)ethanol (CAS 13407-16-4) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 2-chloro-1-(4-nitrophenyl)ethanol. InChIKey: ZUJVGRUIXVTXOX-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 2-chloro-1-(4-nitrophenyl)ethanol |
| InChIKey | ZUJVGRUIXVTXOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CCl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)