CAS 13407-63-1 appears in our catalog under these names: 5,6,7,8-Tetrahydronaphthalene-2-carboxamide, 95%, 5,6,7,8-Tetrahydronaphthalene-2-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5,6,7,8-tetrahydronaphthalene-2-carboxamide (CAS 13407-63-1) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 5,6,7,8-tetrahydronaphthalene-2-carboxamide. InChIKey: QMYMOARPAJVXDF-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| InChIKey | QMYMOARPAJVXDF-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C(=O)N |
Computed by PubChem (NCBI)