Products 1341035-70-8
CAS 1341035-70-8 is the registry number for Ethyl 2-(2-bromoimidazo[2,1-b]thiazol-6-yl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Ethyl 2-(2-bromoimidazo[2,1-b][1,3]thiazol-6-yl)propanoate (CAS 1341035-70-8) is a chemical compound with the molecular formula C10H11BrN2O2S and a molecular weight of 303.18 g/mol. IUPAC name: ethyl 2-(2-bromoimidazo[2,1-b][1,3]thiazol-6-yl)propanoate. InChIKey: FUTSWPJKCJMKIF-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O2S |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | ethyl 2-(2-bromoimidazo[2,1-b][1,3]thiazol-6-yl)propanoate |
| InChIKey | FUTSWPJKCJMKIF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C1=CN2C=C(SC2=N1)Br |
Computed by PubChem (NCBI)