CAS 1355655-04-7 is the registry number for 1-(5-Bromothiophene-3-carbonyl)-1,4-diazepan-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-bromothiophene-3-carbonyl)-1,4-diazepan-5-one (CAS 1355655-04-7) is a chemical compound with the molecular formula C10H11BrN2O2S and a molecular weight of 303.18 g/mol. IUPAC name: 1-(5-bromothiophene-3-carbonyl)-1,4-diazepan-5-one. InChIKey: CKFNMBNOHYLQRG-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O2S |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | 1-(5-bromothiophene-3-carbonyl)-1,4-diazepan-5-one |
| InChIKey | CKFNMBNOHYLQRG-UHFFFAOYSA-N |
| SMILES | C1CN(CCNC1=O)C(=O)C2=CSC(=C2)Br |
Computed by PubChem (NCBI)