CAS 1341117-68-7 is the registry number for 3-(Thiazol-2-ylamino)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothian-3-yl)-1,3-thiazol-2-amine (CAS 1341117-68-7) is a chemical compound with the molecular formula C8H12N2O2S2 and a molecular weight of 232.3 g/mol. IUPAC name: N-(1,1-dioxothian-3-yl)-1,3-thiazol-2-amine. InChIKey: VBFQNIXOXVRCGJ-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S2 |
|---|---|
| Molecular weight | 232.3 g/mol |
| IUPAC name | N-(1,1-dioxothian-3-yl)-1,3-thiazol-2-amine |
| InChIKey | VBFQNIXOXVRCGJ-UHFFFAOYSA-N |
| SMILES | C1CC(CS(=O)(=O)C1)NC2=NC=CS2 |
Computed by PubChem (NCBI)