CAS 1871899-47-6 is the registry number for 3-(((5-Methylthiazol-2-yl)methyl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,1-dioxothietan-3-amine (CAS 1871899-47-6) is a chemical compound with the molecular formula C8H12N2O2S2 and a molecular weight of 232.3 g/mol. IUPAC name: N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,1-dioxothietan-3-amine. InChIKey: VPXAZIPMQSPNEX-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S2 |
|---|---|
| Molecular weight | 232.3 g/mol |
| IUPAC name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,1-dioxothietan-3-amine |
| InChIKey | VPXAZIPMQSPNEX-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)CNC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)