Products 1341166-16-2
CAS 1341166-16-2 is the registry number for 2-Bromo-n-(2-chloro-4-fluorophenyl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-N-(2-chloro-4-fluorophenyl)acetamide (CAS 1341166-16-2) is a chemical compound with the molecular formula C8H6BrClFNO and a molecular weight of 266.49 g/mol. IUPAC name: 2-bromo-N-(2-chloro-4-fluorophenyl)acetamide. InChIKey: BJXXZDILVJGKRC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClFNO |
|---|---|
| Molecular weight | 266.49 g/mol |
| IUPAC name | 2-bromo-N-(2-chloro-4-fluorophenyl)acetamide |
| InChIKey | BJXXZDILVJGKRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)NC(=O)CBr |
Computed by PubChem (NCBI)