Products 349121-13-7
CAS 349121-13-7 appears in our catalog under these names: 2-Bromo-n-(3-chloro-4-fluorophenyl)acetamide, 95%, 2-Bromo-N-(3-chloro-4-fluorophenyl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
2-bromo-N-(3-chloro-4-fluorophenyl)acetamide (CAS 349121-13-7) is a chemical compound with the molecular formula C8H6BrClFNO and a molecular weight of 266.49 g/mol. IUPAC name: 2-bromo-N-(3-chloro-4-fluorophenyl)acetamide. InChIKey: KYGXRNBDSUCFNX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClFNO |
|---|---|
| Molecular weight | 266.49 g/mol |
| IUPAC name | 2-bromo-N-(3-chloro-4-fluorophenyl)acetamide |
| InChIKey | KYGXRNBDSUCFNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CBr)Cl)F |
Computed by PubChem (NCBI)