Products 1341286-54-1

CAS 1341286-54-1 is the registry number for Methyl 1-hydroxy-3,3-dimethylcyclohexane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-hydroxy-3,3-dimethylcyclohexane-1-carboxylate (CAS 1341286-54-1) is a chemical compound with the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. IUPAC name: methyl 1-hydroxy-3,3-dimethylcyclohexane-1-carboxylate. InChIKey: PRQJMHPVLXQYKF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O3
Molecular weight186.25 g/mol
IUPAC namemethyl 1-hydroxy-3,3-dimethylcyclohexane-1-carboxylate
InChIKeyPRQJMHPVLXQYKF-UHFFFAOYSA-N
SMILESCC1(CCCC(C1)(C(=O)OC)O)C

Computed by PubChem (NCBI)