Products 1341347-14-5

CAS 1341347-14-5 is the registry number for 5-Methanesulfonyl-2-propylpentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-methylsulfonyl-2-propylpentanoic acid (CAS 1341347-14-5) is a chemical compound with the molecular formula C9H18O4S and a molecular weight of 222.30 g/mol. IUPAC name: 5-methylsulfonyl-2-propylpentanoic acid. InChIKey: LJOHFKJLNBRWDW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18O4S
Molecular weight222.30 g/mol
IUPAC name5-methylsulfonyl-2-propylpentanoic acid
InChIKeyLJOHFKJLNBRWDW-UHFFFAOYSA-N
SMILESCCCC(CCCS(=O)(=O)C)C(=O)O

Computed by PubChem (NCBI)