CAS 1932776-12-9 is the registry number for rac-(1R,3S)-3-Ethoxy-2,2-dimethylcyclobutyl methanesulfonate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(1S,3R)-3-ethoxy-2,2-dimethylcyclobutyl] methanesulfonate (CAS 1932776-12-9) is a chemical compound with the molecular formula C9H18O4S and a molecular weight of 222.30 g/mol. IUPAC name: [(1S,3R)-3-ethoxy-2,2-dimethylcyclobutyl] methanesulfonate. InChIKey: JRIUFCPYBHRCSR-SFYZADRCSA-N.
| Molecular formula | C9H18O4S |
|---|---|
| Molecular weight | 222.30 g/mol |
| IUPAC name | [(1S,3R)-3-ethoxy-2,2-dimethylcyclobutyl] methanesulfonate |
| InChIKey | JRIUFCPYBHRCSR-SFYZADRCSA-N |
| SMILES | CCO[C@@H]1C[C@@H](C1(C)C)OS(=O)(=O)C |
Computed by PubChem (NCBI)