CAS 1341362-65-9 is the registry number for 6-Chloro-2-cyclopropyl-1,4-dihydroquinolin-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-2-cyclopropyl-1H-quinolin-4-one (CAS 1341362-65-9) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 6-chloro-2-cyclopropyl-1H-quinolin-4-one. InChIKey: DJFMVRBMDIDTSU-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 6-chloro-2-cyclopropyl-1H-quinolin-4-one |
| InChIKey | DJFMVRBMDIDTSU-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=O)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)