Products 1341372-69-7
CAS 1341372-69-7 is the registry number for {3-((3-Fluorophenyl)methyl)-1,2,4-oxadiazol-5-yl}methanol. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
[3-[(3-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanol (CAS 1341372-69-7) is a chemical compound with the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. IUPAC name: [3-[(3-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanol. InChIKey: AAHHLLMCXJOQPG-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O2 |
|---|---|
| Molecular weight | 208.19 g/mol |
| IUPAC name | [3-[(3-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanol |
| InChIKey | AAHHLLMCXJOQPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC2=NOC(=N2)CO |
Computed by PubChem (NCBI)