CAS 1341439-39-1 is the registry number for 1-(4-Fluoro-2-methylphenyl)-3-methyl-1H-1,2,4-triazol-5-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(4-fluoro-2-methylphenyl)-5-methyl-1,2,4-triazol-3-amine (CAS 1341439-39-1) is a chemical compound with the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. IUPAC name: 2-(4-fluoro-2-methylphenyl)-5-methyl-1,2,4-triazol-3-amine. InChIKey: XUFJAYZZLUTDBR-UHFFFAOYSA-N.
| Molecular formula | C10H11FN4 |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 2-(4-fluoro-2-methylphenyl)-5-methyl-1,2,4-triazol-3-amine |
| InChIKey | XUFJAYZZLUTDBR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)N2C(=NC(=N2)C)N |
Computed by PubChem (NCBI)