CAS 1980023-96-8 is the registry number for (S)-1-(6-(4-Fluoro-1H-pyrazol-1-yl)pyridin-3-yl)ethanamine, 95%. Offered by: Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
(1S)-1-[6-(4-fluoropyrazol-1-yl)-3-pyridinyl]ethanamine (CAS 1980023-96-8) is a chemical compound with the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. IUPAC name: (1S)-1-[6-(4-fluoropyrazol-1-yl)-3-pyridinyl]ethanamine. InChIKey: VOWGRXGCGYJWNO-ZETCQYMHSA-N.
| Molecular formula | C10H11FN4 |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | (1S)-1-[6-(4-fluoropyrazol-1-yl)-3-pyridinyl]ethanamine |
| InChIKey | VOWGRXGCGYJWNO-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=CN=C(C=C1)N2C=C(C=N2)F)N |
Computed by PubChem (NCBI)