Products 1341456-39-0
CAS 1341456-39-0 is the registry number for (2,4-Difluorophenyl)(piperidin-2-yl)methanone hydrochloride. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg.
(2,4-difluorophenyl)-piperidin-2-ylmethanone (CAS 1341456-39-0) is a chemical compound with the molecular formula C12H13F2NO and a molecular weight of 225.23 g/mol. IUPAC name: (2,4-difluorophenyl)-piperidin-2-ylmethanone. InChIKey: XXBNUYRVTZVHQQ-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO |
|---|---|
| Molecular weight | 225.23 g/mol |
| IUPAC name | (2,4-difluorophenyl)-piperidin-2-ylmethanone |
| InChIKey | XXBNUYRVTZVHQQ-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C(=O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)