CAS 351038-82-9 appears in our catalog under these names: 1-(2,3-Difluorobenzoyl)piperidine, 95%, (2,3-Difluorophenyl)(piperidin-1-yl)methanone, 98%, (2,3-Difluorophenyl)(piperidin-1-yl)methanone. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(2,3-difluorophenyl)-piperidin-1-ylmethanone (CAS 351038-82-9) is a chemical compound with the molecular formula C12H13F2NO and a molecular weight of 225.23 g/mol. IUPAC name: (2,3-difluorophenyl)-piperidin-1-ylmethanone. InChIKey: PJIJKWKKKLUZQB-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO |
|---|---|
| Molecular weight | 225.23 g/mol |
| IUPAC name | (2,3-difluorophenyl)-piperidin-1-ylmethanone |
| InChIKey | PJIJKWKKKLUZQB-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=C(C(=CC=C2)F)F |
Computed by PubChem (NCBI)