CAS 1341599-69-6 appears in our catalog under these names: N-(2-Amino-5-fluorophenyl)methanesulfonamide, 98%, N-(2-Amino-5-fluorophenyl)methanesulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
N-(2-amino-5-fluorophenyl)methanesulfonamide (CAS 1341599-69-6) is a chemical compound with the molecular formula C7H9FN2O2S and a molecular weight of 204.22 g/mol. IUPAC name: N-(2-amino-5-fluorophenyl)methanesulfonamide. InChIKey: RWXSHEPMWDRBNR-UHFFFAOYSA-N.
| Molecular formula | C7H9FN2O2S |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | N-(2-amino-5-fluorophenyl)methanesulfonamide |
| InChIKey | RWXSHEPMWDRBNR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=CC(=C1)F)N |
Computed by PubChem (NCBI)