Products 926270-06-6
CAS 926270-06-6 is the registry number for N-(3-Amino-4-fluorophenyl)methanesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
N-(3-amino-4-fluorophenyl)methanesulfonamide (CAS 926270-06-6) is a chemical compound with the molecular formula C7H9FN2O2S and a molecular weight of 204.22 g/mol. IUPAC name: N-(3-amino-4-fluorophenyl)methanesulfonamide. InChIKey: VDHHFCYTUBBLSF-UHFFFAOYSA-N.
| Molecular formula | C7H9FN2O2S |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | N-(3-amino-4-fluorophenyl)methanesulfonamide |
| InChIKey | VDHHFCYTUBBLSF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC(=C(C=C1)F)N |
Computed by PubChem (NCBI)