CAS 1341609-10-6 appears in our catalog under these names: 5-Bromo-8-fluoro-1,2-dihydroquinolin-2-one, 5-Bromo-8-fluoroquinolin-2(1H)-one 97%, 5-Bromo-8-fluoroquinolin-2(1H)-one, 97%, 97%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg.
5-bromo-8-fluoro-1H-quinolin-2-one (CAS 1341609-10-6) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 5-bromo-8-fluoro-1H-quinolin-2-one. InChIKey: KQKSIZGEZCJLMJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 5-bromo-8-fluoro-1H-quinolin-2-one |
| InChIKey | KQKSIZGEZCJLMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C(C=CC(=C21)Br)F |
Computed by PubChem (NCBI)