CAS 1341736-93-3 appears in our catalog under these names: (4-Bromo-2-(trifluoromethyl)phenyl)(cyclopropyl)methanone, 95%, (4-Bromo-2-(trifluoromethyl)phenyl)(cyclopropyl)methanone. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
[4-bromo-2-(trifluoromethyl)phenyl]-cyclopropylmethanone (CAS 1341736-93-3) is a chemical compound with the molecular formula C11H8BrF3O and a molecular weight of 293.08 g/mol. IUPAC name: [4-bromo-2-(trifluoromethyl)phenyl]-cyclopropylmethanone. InChIKey: FJBPGXYEYDPQHI-UHFFFAOYSA-N.
| Molecular formula | C11H8BrF3O |
|---|---|
| Molecular weight | 293.08 g/mol |
| IUPAC name | [4-bromo-2-(trifluoromethyl)phenyl]-cyclopropylmethanone |
| InChIKey | FJBPGXYEYDPQHI-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=C(C=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)