Products 2125962-67-4
CAS 2125962-67-4 is the registry number for (3-Bromo-5-(trifluoromethyl)phenyl)(cyclopropyl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-bromo-5-(trifluoromethyl)phenyl]-cyclopropylmethanone (CAS 2125962-67-4) is a chemical compound with the molecular formula C11H8BrF3O and a molecular weight of 293.08 g/mol. IUPAC name: [3-bromo-5-(trifluoromethyl)phenyl]-cyclopropylmethanone. InChIKey: PSTUVIQUHBZGRI-UHFFFAOYSA-N.
| Molecular formula | C11H8BrF3O |
|---|---|
| Molecular weight | 293.08 g/mol |
| IUPAC name | [3-bromo-5-(trifluoromethyl)phenyl]-cyclopropylmethanone |
| InChIKey | PSTUVIQUHBZGRI-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC(=CC(=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)