CAS 1341814-38-7 appears in our catalog under these names: 1-(1-Bromopropyl)-2,4-dichlorobenzene, 95%, 1-(1-Bromopropyl)-2,4-dichlorobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-(1-bromopropyl)-2,4-dichlorobenzene (CAS 1341814-38-7) is a chemical compound with the molecular formula C9H9BrCl2 and a molecular weight of 267.97 g/mol. IUPAC name: 1-(1-bromopropyl)-2,4-dichlorobenzene. InChIKey: DCTBBGVHKKVDPU-UHFFFAOYSA-N.
| Molecular formula | C9H9BrCl2 |
|---|---|
| Molecular weight | 267.97 g/mol |
| IUPAC name | 1-(1-bromopropyl)-2,4-dichlorobenzene |
| InChIKey | DCTBBGVHKKVDPU-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C=C(C=C1)Cl)Cl)Br |
Computed by PubChem (NCBI)