CAS 2918852-83-0 is the registry number for 2-Bromo-1,3-dichloro-4-isopropylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1,3-dichloro-4-propan-2-ylbenzene (CAS 2918852-83-0) is a chemical compound with the molecular formula C9H9BrCl2 and a molecular weight of 267.97 g/mol. IUPAC name: 2-bromo-1,3-dichloro-4-propan-2-ylbenzene. InChIKey: KNZOSURWGANWCA-UHFFFAOYSA-N.
| Molecular formula | C9H9BrCl2 |
|---|---|
| Molecular weight | 267.97 g/mol |
| IUPAC name | 2-bromo-1,3-dichloro-4-propan-2-ylbenzene |
| InChIKey | KNZOSURWGANWCA-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C=C1)Cl)Br)Cl |
Computed by PubChem (NCBI)