CAS 1341874-47-2 appears in our catalog under these names: 1-(2-Methanesulfonylethyl)-3,5-dimethyl-1H-pyrazole, 1-(2-Methanesulfonylethyl)-3,5-dimethyl-1H-pyrazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazole (CAS 1341874-47-2) is a chemical compound with the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. IUPAC name: 3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazole. InChIKey: RPBXVMAUUMACKC-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 3,5-dimethyl-1-(2-methylsulfonylethyl)pyrazole |
| InChIKey | RPBXVMAUUMACKC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CCS(=O)(=O)C)C |
Computed by PubChem (NCBI)