CAS 2088353-66-4 is the registry number for 4-Amino-1-methyl-2λâ¶-thia-1-azaspiro(4.4)non-3-ene-2,2-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-2,2-dioxo-2lambda6-thia-1-azaspiro[4.4]non-3-en-4-amine (CAS 2088353-66-4) is a chemical compound with the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. IUPAC name: 1-methyl-2,2-dioxo-2lambda6-thia-1-azaspiro[4.4]non-3-en-4-amine. InChIKey: DHELMMVHSJHHJZ-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 1-methyl-2,2-dioxo-2lambda6-thia-1-azaspiro[4.4]non-3-en-4-amine |
| InChIKey | DHELMMVHSJHHJZ-UHFFFAOYSA-N |
| SMILES | CN1C2(CCCC2)C(=CS1(=O)=O)N |
Computed by PubChem (NCBI)