Products 1342026-72-5
CAS 1342026-72-5 is the registry number for 3-(3-(Trifluoromethyl)-1H-pyrazol-1-yl)phenol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[3-(trifluoromethyl)pyrazol-1-yl]phenol (CAS 1342026-72-5) is a chemical compound with the molecular formula C10H7F3N2O and a molecular weight of 228.17 g/mol. IUPAC name: 3-[3-(trifluoromethyl)pyrazol-1-yl]phenol. InChIKey: WRDGJEBUKAOQFH-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)pyrazol-1-yl]phenol |
| InChIKey | WRDGJEBUKAOQFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)N2C=CC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)