CAS 32527-84-7 is the registry number for Aβ1–42 aggregation inhibitor 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methyl-4-(4-nitrophenyl)sulfanyl-1-phenylpyrazol-5-amine (CAS 32527-84-7) is a chemical compound with the molecular formula C16H14N4O2S and a molecular weight of 326.4 g/mol. IUPAC name: 3-methyl-4-(4-nitrophenyl)sulfanyl-1-phenylpyrazol-5-amine. InChIKey: YXPSKDWPGKXZED-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O2S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 3-methyl-4-(4-nitrophenyl)sulfanyl-1-phenylpyrazol-5-amine |
| InChIKey | YXPSKDWPGKXZED-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1SC2=CC=C(C=C2)[N+](=O)[O-])N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)