CAS 134235-86-2 appears in our catalog under these names: H–β–(2–Thiazolyl)–Ala–OH, H-beta-(2-Thiazolyl)-Ala-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 25mg.
(2S)-2-amino-3-(1,3-thiazol-2-yl)propanoic acid (CAS 134235-86-2) is a chemical compound with the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. IUPAC name: (2S)-2-amino-3-(1,3-thiazol-2-yl)propanoic acid. InChIKey: PXFXXRSFSGRBRT-BYPYZUCNSA-N.
| Molecular formula | C6H8N2O2S |
|---|---|
| Molecular weight | 172.21 g/mol |
| IUPAC name | (2S)-2-amino-3-(1,3-thiazol-2-yl)propanoic acid |
| InChIKey | PXFXXRSFSGRBRT-BYPYZUCNSA-N |
| SMILES | C1=CSC(=N1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)