CAS 134235-87-3 is the registry number for (R)-2-Amino-3-(thiazol-2-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-3-(1,3-thiazol-2-yl)propanoic acid (CAS 134235-87-3) is a chemical compound with the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. IUPAC name: (2R)-2-amino-3-(1,3-thiazol-2-yl)propanoic acid. InChIKey: PXFXXRSFSGRBRT-SCSAIBSYSA-N.
| Molecular formula | C6H8N2O2S |
|---|---|
| Molecular weight | 172.21 g/mol |
| IUPAC name | (2R)-2-amino-3-(1,3-thiazol-2-yl)propanoic acid |
| InChIKey | PXFXXRSFSGRBRT-SCSAIBSYSA-N |
| SMILES | C1=CSC(=N1)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)