Products 1342424-21-8
CAS 1342424-21-8 appears in our catalog under these names: 4-Chloro-2-(difluoromethyl)-1h-1,3-benzodiazole, 95%, 2-(Difluoromethyl)-4-chloro-1H-benzimidazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10g.
4-chloro-2-(difluoromethyl)-1H-benzimidazole (CAS 1342424-21-8) is a chemical compound with the molecular formula C8H5ClF2N2 and a molecular weight of 202.59 g/mol. IUPAC name: 4-chloro-2-(difluoromethyl)-1H-benzimidazole. InChIKey: QLGGJNSAAQWRRN-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2N2 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 4-chloro-2-(difluoromethyl)-1H-benzimidazole |
| InChIKey | QLGGJNSAAQWRRN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(N2)C(F)F |
Computed by PubChem (NCBI)