Products 91437-08-0
CAS 91437-08-0 appears in our catalog under these names: 5-Chloro-2-(difluoromethyl)-1h-1,3-benzodiazole, 95%, 2-(Difluoromethyl)-5-chloro-1H-benzimidazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
6-chloro-2-(difluoromethyl)-1H-benzimidazole (CAS 91437-08-0) is a chemical compound with the molecular formula C8H5ClF2N2 and a molecular weight of 202.59 g/mol. IUPAC name: 6-chloro-2-(difluoromethyl)-1H-benzimidazole. InChIKey: RQDLGCYUQHYKLK-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2N2 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 6-chloro-2-(difluoromethyl)-1H-benzimidazole |
| InChIKey | RQDLGCYUQHYKLK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=N2)C(F)F |
Computed by PubChem (NCBI)