Products 1342664-48-5
CAS 1342664-48-5 is the registry number for 1-(2-Chloro-4-(morpholin-4-yl)phenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-chloro-4-morpholin-4-ylphenyl)ethanone (CAS 1342664-48-5) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: 1-(2-chloro-4-morpholin-4-ylphenyl)ethanone. InChIKey: QIAZDKGVNJAOBG-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO2 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 1-(2-chloro-4-morpholin-4-ylphenyl)ethanone |
| InChIKey | QIAZDKGVNJAOBG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)N2CCOCC2)Cl |
Computed by PubChem (NCBI)