Products 1342789-21-2

CAS 1342789-21-2 is the registry number for 2-((Methylthio)methyl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(methylsulfanylmethyl)-1,3-thiazole-4-carboxylic acid (CAS 1342789-21-2) is a chemical compound with the molecular formula C6H7NO2S2 and a molecular weight of 189.3 g/mol. IUPAC name: 2-(methylsulfanylmethyl)-1,3-thiazole-4-carboxylic acid. InChIKey: HHATYCZQUYXPPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO2S2
Molecular weight189.3 g/mol
IUPAC name2-(methylsulfanylmethyl)-1,3-thiazole-4-carboxylic acid
InChIKeyHHATYCZQUYXPPQ-UHFFFAOYSA-N
SMILESCSCC1=NC(=CS1)C(=O)O

Computed by PubChem (NCBI)