Products 5685-17-6

CAS 5685-17-6 is the registry number for [(4-Methyl-1,3-thiazol-2-yl)thio]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetic acid (CAS 5685-17-6) is a chemical compound with the molecular formula C6H7NO2S2 and a molecular weight of 189.3 g/mol. IUPAC name: 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetic acid. InChIKey: SMTQOYIRMDGTAY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO2S2
Molecular weight189.3 g/mol
IUPAC name2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetic acid
InChIKeySMTQOYIRMDGTAY-UHFFFAOYSA-N
SMILESCC1=CSC(=N1)SCC(=O)O

Computed by PubChem (NCBI)