Products 13430-27-8

CAS 13430-27-8 is the registry number for 2-Fluoro-3,4-dihydroxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-fluoro-3,4-dihydroxybenzoic acid (CAS 13430-27-8) is a chemical compound with the molecular formula C7H5FO4 and a molecular weight of 172.11 g/mol. IUPAC name: 2-fluoro-3,4-dihydroxybenzoic acid. InChIKey: QVCKWFKEKPOSQC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5FO4
Molecular weight172.11 g/mol
IUPAC name2-fluoro-3,4-dihydroxybenzoic acid
InChIKeyQVCKWFKEKPOSQC-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)F)O)O

Computed by PubChem (NCBI)