CAS 13430-27-8 is the registry number for 2-Fluoro-3,4-dihydroxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-3,4-dihydroxybenzoic acid (CAS 13430-27-8) is a chemical compound with the molecular formula C7H5FO4 and a molecular weight of 172.11 g/mol. IUPAC name: 2-fluoro-3,4-dihydroxybenzoic acid. InChIKey: QVCKWFKEKPOSQC-UHFFFAOYSA-N.
| Molecular formula | C7H5FO4 |
|---|---|
| Molecular weight | 172.11 g/mol |
| IUPAC name | 2-fluoro-3,4-dihydroxybenzoic acid |
| InChIKey | QVCKWFKEKPOSQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)O)O |
Computed by PubChem (NCBI)