CAS 492444-05-0 appears in our catalog under these names: 6-Fluoro-2,3-dihydroxybenzoic acid, 95%, 6-Fluoro-2,3-dihydroxybenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6-fluoro-2,3-dihydroxybenzoic acid (CAS 492444-05-0) is a chemical compound with the molecular formula C7H5FO4 and a molecular weight of 172.11 g/mol. IUPAC name: 6-fluoro-2,3-dihydroxybenzoic acid. InChIKey: LDVNZXZKWHFOMJ-UHFFFAOYSA-N.
| Molecular formula | C7H5FO4 |
|---|---|
| Molecular weight | 172.11 g/mol |
| IUPAC name | 6-fluoro-2,3-dihydroxybenzoic acid |
| InChIKey | LDVNZXZKWHFOMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)O)C(=O)O)F |
Computed by PubChem (NCBI)