Products 1343182-79-5
CAS 1343182-79-5 is the registry number for 2-methyl-1-(3-(trifluoromethoxy)phenyl)propan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methyl-1-[3-(trifluoromethoxy)phenyl]propan-1-ol (CAS 1343182-79-5) is a chemical compound with the molecular formula C11H13F3O2 and a molecular weight of 234.21 g/mol. IUPAC name: 2-methyl-1-[3-(trifluoromethoxy)phenyl]propan-1-ol. InChIKey: YXXJFYGVHZQUOH-UHFFFAOYSA-N.
| Molecular formula | C11H13F3O2 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 2-methyl-1-[3-(trifluoromethoxy)phenyl]propan-1-ol |
| InChIKey | YXXJFYGVHZQUOH-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC(=CC=C1)OC(F)(F)F)O |
Computed by PubChem (NCBI)