CAS 1343186-84-4 appears in our catalog under these names: 4-(4-Bromobutyl)-1,2-dichlorobenzene, 4-(4-Bromobutyl)-1,2-dichlorobenzene, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
4-(4-bromobutyl)-1,2-dichlorobenzene (CAS 1343186-84-4) is a chemical compound with the molecular formula C10H11BrCl2 and a molecular weight of 282.00 g/mol. IUPAC name: 4-(4-bromobutyl)-1,2-dichlorobenzene. InChIKey: CTWUHPGFXJHKFX-UHFFFAOYSA-N.
| Molecular formula | C10H11BrCl2 |
|---|---|
| Molecular weight | 282.00 g/mol |
| IUPAC name | 4-(4-bromobutyl)-1,2-dichlorobenzene |
| InChIKey | CTWUHPGFXJHKFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCCCBr)Cl)Cl |
Computed by PubChem (NCBI)