CAS 2409562-95-2 appears in our catalog under these names: 1-Bromo-5-(tert-butyl)-2,3-dichlorobenzene, 97%, 1-Bromo-5-(tert-butyl)-2,3-dichlorobenzene, 97%, 97%, 1-Bromo-2,3-dichloro-5-(1,1-dimethylethyl)benzene, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g.
1-bromo-5-tert-butyl-2,3-dichlorobenzene (CAS 2409562-95-2) is a chemical compound with the molecular formula C10H11BrCl2 and a molecular weight of 282.00 g/mol. IUPAC name: 1-bromo-5-tert-butyl-2,3-dichlorobenzene. InChIKey: UWWPYEJTHUDXHP-UHFFFAOYSA-N.
| Molecular formula | C10H11BrCl2 |
|---|---|
| Molecular weight | 282.00 g/mol |
| IUPAC name | 1-bromo-5-tert-butyl-2,3-dichlorobenzene |
| InChIKey | UWWPYEJTHUDXHP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)