CAS 1343260-06-9 is the registry number for (3-(3-Chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanol (CAS 1343260-06-9) is a chemical compound with the molecular formula C9H6ClFN2O2 and a molecular weight of 228.61 g/mol. IUPAC name: [3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanol. InChIKey: LSNZTKYMTMAFMB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O2 |
|---|---|
| Molecular weight | 228.61 g/mol |
| IUPAC name | [3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanol |
| InChIKey | LSNZTKYMTMAFMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NOC(=N2)CO)Cl)F |
Computed by PubChem (NCBI)