CAS 1934801-60-1 appears in our catalog under these names: 5-Chloro-3-(3-fluoro-5-methoxyphenyl)-1,2,4-oxadiazole, 95%, 5-Chloro-3-(3-fluoro-5-methoxyphenyl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chloro-3-(3-fluoro-5-methoxyphenyl)-1,2,4-oxadiazole (CAS 1934801-60-1) is a chemical compound with the molecular formula C9H6ClFN2O2 and a molecular weight of 228.61 g/mol. IUPAC name: 5-chloro-3-(3-fluoro-5-methoxyphenyl)-1,2,4-oxadiazole. InChIKey: GFZFKCKGLSAAEF-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O2 |
|---|---|
| Molecular weight | 228.61 g/mol |
| IUPAC name | 5-chloro-3-(3-fluoro-5-methoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | GFZFKCKGLSAAEF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=NOC(=N2)Cl)F |
Computed by PubChem (NCBI)