CAS 1343317-66-7 appears in our catalog under these names: 2-(Tetrahydro-2H-pyran-4-yl)thiazole-5-carboxylic acid, 97%, 2-(Oxan-4-yl)-1,3-thiazole-5-carboxylic acid, 2-(Tetrahydro-2H-pyran-4-yl)thiazole-5-carboxylic acid, 97%, 97%, 2-(Oxan-4-yl)-1,3-thiazole-5-carboxylic acid, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
2-(oxan-4-yl)-1,3-thiazole-5-carboxylic acid (CAS 1343317-66-7) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: 2-(oxan-4-yl)-1,3-thiazole-5-carboxylic acid. InChIKey: SBXVQXNODXBJMB-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | 2-(oxan-4-yl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | SBXVQXNODXBJMB-UHFFFAOYSA-N |
| SMILES | C1COCCC1C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)