Products 1343343-22-5
CAS 1343343-22-5 is the registry number for 4-(3-tert-Butyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one (CAS 1343343-22-5) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one. InChIKey: RNXBAPKINSVSJX-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one |
| InChIKey | RNXBAPKINSVSJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NOC(=N1)C2CCC(=O)CC2 |
Computed by PubChem (NCBI)