CAS 1343476-61-8 is the registry number for L-Valine, n-[(2-propen-1-yloxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoate (CAS 1343476-61-8) is a chemical compound with the molecular formula C13H18N2O6 and a molecular weight of 298.29 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoate. InChIKey: DESCYYXQPKEAGY-NSHDSACASA-N.
| Molecular formula | C13H18N2O6 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoate |
| InChIKey | DESCYYXQPKEAGY-NSHDSACASA-N |
| SMILES | CC(C)[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OCC=C |
Computed by PubChem (NCBI)