CAS 74536-44-0 appears in our catalog under these names: Metadoxine, Metadoxine, >95% (HPLC), Metadoxine/ 100%, Metadoxine 97%, Metadoxine, 97%, 97%. Offered by: Chemat Brand, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: on request, 1g, 25mg, 5g, 100mg, 200mg, 500mg, 500g.
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-5-oxopyrrolidine-2-carboxylic acid (CAS 74536-44-0) is a chemical compound with the molecular formula C13H18N2O6 and a molecular weight of 298.29 g/mol. IUPAC name: 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-5-oxopyrrolidine-2-carboxylic acid. InChIKey: RYKKQQUKJJGFMN-HVDRVSQOSA-N.
| Molecular formula | C13H18N2O6 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-5-oxopyrrolidine-2-carboxylic acid |
| InChIKey | RYKKQQUKJJGFMN-HVDRVSQOSA-N |
| SMILES | CC1=NC=C(C(=C1O)CO)CO.C1CC(=O)N[C@@H]1C(=O)O |
Computed by PubChem (NCBI)