Products 13437-79-1
CAS 13437-79-1 appears in our catalog under these names: 1–Phenylethylamine (hydrochloride), 1-Phenylethylamine hydrochloride, 1-Phenylethylamine (hydrochloride), 1-Phenylethylamine hydrochloride, 98%, alpha-Phenylethylamine Hydrochloride. Offered by: GLPBio, Biosynth, MedChemExpress, Combi-blocks, Mikromol. Available pack sizes: 100mg, 25mg, 50g, 25g, 100g, 100 mg, 50 mg, 25 mg.
1-phenylethylazanium chloride (CAS 13437-79-1) is a chemical compound with the molecular formula C8H12ClN and a molecular weight of 157.64 g/mol. IUPAC name: 1-phenylethylazanium chloride. InChIKey: YEHGSOZIZRABBU-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN |
|---|---|
| Molecular weight | 157.64 g/mol |
| IUPAC name | 1-phenylethylazanium chloride |
| InChIKey | YEHGSOZIZRABBU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)[NH3+].[Cl-] |
Computed by PubChem (NCBI)