Products 2739-05-1

CAS 2739-05-1 is the registry number for N,4-Dimethylaniline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

N,4-dimethylaniline;hydrochloride (CAS 2739-05-1) is a chemical compound with the molecular formula C8H12ClN and a molecular weight of 157.64 g/mol. IUPAC name: N,4-dimethylaniline;hydrochloride. InChIKey: ZRJNYPNQRUQREW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12ClN
Molecular weight157.64 g/mol
IUPAC nameN,4-dimethylaniline;hydrochloride
InChIKeyZRJNYPNQRUQREW-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)NC.Cl

Computed by PubChem (NCBI)