CAS 1343748-74-2 is the registry number for 7,9-Dibromo-2,3,4,5-tetrahydrobenzo[b]oxepin-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7,9-dibromo-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (CAS 1343748-74-2) is a chemical compound with the molecular formula C10H11Br2NO and a molecular weight of 321.01 g/mol. IUPAC name: 7,9-dibromo-2,3,4,5-tetrahydro-1-benzoxepin-5-amine. InChIKey: UORWQWKYKDJWMX-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2NO |
|---|---|
| Molecular weight | 321.01 g/mol |
| IUPAC name | 7,9-dibromo-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| InChIKey | UORWQWKYKDJWMX-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C(=CC(=C2)Br)Br)OC1)N |
Computed by PubChem (NCBI)